C24H21ClIN3O3 — CID 126386157
(Z)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide (PubChem CID 126386157) has the molecular formula C24H21ClIN3O3 and a molecular weight of 561.81 g/mol. Its IUPAC name is (Z)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126386157 |
| Molecular Formula | C24H21ClIN3O3 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.03 |
| IUPAC Name | (Z)-3-[4-[(2-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-2-cyano-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nn2c(C)ccc2C)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H21ClIN3O3/c1-15-8-9-16(2)29(15)28-24(30)19(13-27)10-17-11-21(26)23(22(12-17)31-3)32-14-18-6-4-5-7-20(18)25/h4-12H,14H2,1-3H3,(H,28,30)/b19-10- |
| InChIKey | HDKQKVPERKBVSD-GRSHGNNSSA-N |
| XLogP | 5.63 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|