C20H17Cl2IN2O3 — CID 124534374
(Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N,N-dimethylprop-2-enamide (PubChem CID 124534374) has the molecular formula C20H17Cl2IN2O3 and a molecular weight of 531.18 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N,N-dimethylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 124534374 |
| Molecular Formula | C20H17Cl2IN2O3 |
| Molecular Weight | 531.18 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]-N,N-dimethylprop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N(C)C)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2IN2O3/c1-25(2)20(26)14(10-24)6-12-7-17(23)19(18(8-12)27-3)28-11-13-4-5-15(21)9-16(13)22/h4-9H,11H2,1-3H3/b14-6- |
| InChIKey | RLJBTWPVJQQAQO-NSIKDUERSA-N |
| XLogP | 5.18 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.18 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|