C18H12Cl2INO4 — CID 124580024
2-[4-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]-2-iodo-6-methoxyphenoxy]acetic acid (PubChem CID 124580024) has the molecular formula C18H12Cl2INO4 and a molecular weight of 504.11 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]-2-iodo-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]-2-iodo-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 124580024 |
| Molecular Formula | C18H12Cl2INO4 |
| Molecular Weight | 504.11 g/mol |
| Exact Mass | 502.92 |
| IUPAC Name | 2-[4-[(E)-2-cyano-2-(2,4-dichlorophenyl)ethenyl]-2-iodo-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(Cl)cc2Cl)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C18H12Cl2INO4/c1-25-16-6-10(5-15(21)18(16)26-9-17(23)24)4-11(8-22)13-3-2-12(19)7-14(13)20/h2-7H,9H2,1H3,(H,23,24)/b11-4- |
| InChIKey | JFKKYRYKOZUJBE-WCIBSUBMSA-N |
| XLogP | 5.13 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|