C19H15ClINO2 — CID 2201523
(E)-2-(4-chlorophenyl)-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enenitrile (PubChem CID 2201523) has the molecular formula C19H15ClINO2 and a molecular weight of 451.69 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2201523 |
| Molecular Formula | C19H15ClINO2 |
| Molecular Weight | 451.69 g/mol |
| Exact Mass | 450.98 |
| IUPAC Name | (E)-2-(4-chlorophenyl)-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enenitrile |
| SMILES | C=CCOc1c(I)cc(/C=C(/C#N)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C19H15ClINO2/c1-3-8-24-19-17(21)10-13(11-18(19)23-2)9-15(12-22)14-4-6-16(20)7-5-14/h3-7,9-11H,1,8H2,2H3/b15-9- |
| InChIKey | RZYJLOAJTCCYPU-DHDCSXOGSA-N |
| XLogP | 5.58 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.69 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|