C16H16INO4 — CID 632976
ethyl 2-cyano-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 632976) has the molecular formula C16H16INO4 and a molecular weight of 413.21 g/mol. Its IUPAC name is ethyl 2-cyano-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 632976 |
| Molecular Formula | C16H16INO4 |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | ethyl 2-cyano-3-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1c(I)cc(C=C(C#N)C(=O)OCC)cc1OC |
| InChI | InChI=1S/C16H16INO4/c1-4-6-22-15-13(17)8-11(9-14(15)20-3)7-12(10-18)16(19)21-5-2/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | XKMKGFIYAKRDQG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|