C19H15Cl2NO4 — CID 1291084
2-[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 1291084) has the molecular formula C19H15Cl2NO4 and a molecular weight of 392.24 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 1291084 |
| Molecular Formula | C19H15Cl2NO4 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-[2-chloro-4-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc(Cl)cc2)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C19H15Cl2NO4/c1-2-25-17-9-12(8-16(21)19(17)26-11-18(23)24)7-14(10-22)13-3-5-15(20)6-4-13/h3-9H,2,11H2,1H3,(H,23,24)/b14-7- |
| InChIKey | PEGMZBLBRSXZCB-AUWJEWJLSA-N |
| XLogP | 4.92 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|