C27H25ClN2O3 — CID 21375425
2-[2-chloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 21375425) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 21375425 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[2-chloro-4-[(E)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C(/C#N)c2ccc(C)cc2)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C27H25ClN2O3/c1-4-32-25-15-20(13-22(16-29)21-9-5-18(2)6-10-21)14-24(28)27(25)33-17-26(31)30-23-11-7-19(3)8-12-23/h5-15H,4,17H2,1-3H3,(H,30,31)/b22-13- |
| InChIKey | WHPFGOJSGKZUOP-XKZIYDEJSA-N |
| XLogP | 6.44 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|