C26H23ClN2O3 — CID 124652556
2-[2-chloro-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-phenylacetamide (PubChem CID 124652556) has the molecular formula C26H23ClN2O3 and a molecular weight of 446.93 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 124652556 |
| Molecular Formula | C26H23ClN2O3 |
| Molecular Weight | 446.93 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-6-ethoxyphenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(/C=C(\C#N)c2ccc(C)cc2)cc(Cl)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H23ClN2O3/c1-3-31-24-15-19(13-21(16-28)20-11-9-18(2)10-12-20)14-23(27)26(24)32-17-25(30)29-22-7-5-4-6-8-22/h4-15H,3,17H2,1-2H3,(H,29,30)/b21-13+ |
| InChIKey | DKYBWCSOBXJWGD-FYJGNVAPSA-N |
| XLogP | 6.13 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.93 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|