C19H17Cl2NO2 — CID 2203509
(Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(4-chlorophenyl)prop-2-enenitrile (PubChem CID 2203509) has the molecular formula C19H17Cl2NO2 and a molecular weight of 362.26 g/mol. Its IUPAC name is (Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(4-chlorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(4-chlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2203509 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (Z)-3-(3-chloro-4,5-diethoxyphenyl)-2-(4-chlorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)c2ccc(Cl)cc2)cc(Cl)c1OCC |
| InChI | InChI=1S/C19H17Cl2NO2/c1-3-23-18-11-13(10-17(21)19(18)24-4-2)9-15(12-22)14-5-7-16(20)8-6-14/h5-11H,3-4H2,1-2H3/b15-9+ |
| InChIKey | OKDDHCJAYILTFW-OQLLNIDSSA-N |
| XLogP | 5.85 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|