C29H28ClNO6 — CID 19175164
[4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-triethoxybenzoate (PubChem CID 19175164) has the molecular formula C29H28ClNO6 and a molecular weight of 522.00 g/mol. Its IUPAC name is [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-triethoxybenzoate.
| Compound Name | [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 19175164 |
| Molecular Formula | C29H28ClNO6 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)Oc2ccc(/C=C(\C#N)c3ccc(Cl)cc3)cc2OC)cc(OCC)c1OCC |
| InChI | InChI=1S/C29H28ClNO6/c1-5-34-26-16-21(17-27(35-6-2)28(26)36-7-3)29(32)37-24-13-8-19(15-25(24)33-4)14-22(18-31)20-9-11-23(30)12-10-20/h8-17H,5-7H2,1-4H3/b22-14+ |
| InChIKey | WYRRXIHNURZYHA-HYARGMPZSA-N |
| XLogP | 6.83 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|