About [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate
[4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate (PubChem CID 19170563) has the molecular formula C23H15Cl2NO3
and a molecular weight of 424.28 g/mol. Its IUPAC name is [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate |
| PubChem CID | 19170563 |
| Molecular Formula | C23H15Cl2NO3 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate |
| SMILES | COc1cc(/C=C(\C#N)c2ccc(Cl)cc2)ccc1OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H15Cl2NO3/c1-28-22-12-15(11-18(14-26)16-6-8-19(24)9-7-16)5-10-21(22)29-23(27)17-3-2-4-20(25)13-17/h2-13H,1H3/b18-11+ |
| InChIKey | IXRHYAFXOVKSPD-WOJGMQOQSA-N |
| XLogP | 6.29 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate?
The IUPAC name of [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate (CID 19170563) is [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate.
What is the SMILES notation for [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate?
The canonical SMILES for [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate is COc1cc(/C=C(\C#N)c2ccc(Cl)cc2)ccc1OC(=O)c1cccc(Cl)c1.
What is the InChIKey of [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate?
The InChIKey is IXRHYAFXOVKSPD-WOJGMQOQSA-N. The full InChI is InChI=1S/C23H15Cl2NO3/c1-28-22-12-15(11-18(14-26)16-6-8-19(24)9-7-16)5-10-21(22)29-23(27)17-3-2-4-20(25)13-17/h2-13H,1H3/b18-11+.
What are the key properties of [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate?
[4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate has a molecular weight of 424.28 g/mol, XLogP of 6.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-chlorobenzoate is sourced from PubChem (CID 19170563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).