C26H23NO5 — CID 39114483
[4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 3-methylbenzoate (PubChem CID 39114483) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 3-methylbenzoate.
| Compound Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 39114483 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 3-methylbenzoate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)c3cccc(C)c3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H23NO5/c1-17-6-5-7-20(12-17)26(28)32-23-10-8-18(14-24(23)30-3)13-21(16-27)19-9-11-22(29-2)25(15-19)31-4/h5-15H,1-4H3/b21-13- |
| InChIKey | NDMJZLGIVHNYFQ-BKUYFWCQSA-N |
| XLogP | 5.30 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|