About [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate
[4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate (PubChem CID 39114660) has the molecular formula C24H18BrNO4
and a molecular weight of 464.32 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate.
Molecular Properties
| Compound Name | [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate |
| PubChem CID | 39114660 |
| Molecular Formula | C24H18BrNO4 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)c3cccc(Br)c3)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H18BrNO4/c1-28-21-9-7-17(8-10-21)19(15-26)12-16-6-11-22(23(13-16)29-2)30-24(27)18-4-3-5-20(25)14-18/h3-14H,1-2H3/b19-12- |
| InChIKey | UPRAHIFEMVLOGQ-UNOMPAQXSA-N |
| XLogP | 5.75 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate?
The IUPAC name of [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate (CID 39114660) is [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate.
What is the SMILES notation for [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate?
The canonical SMILES for [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate is COc1ccc(/C(C#N)=C\c2ccc(OC(=O)c3cccc(Br)c3)c(OC)c2)cc1.
What is the InChIKey of [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate?
The InChIKey is UPRAHIFEMVLOGQ-UNOMPAQXSA-N. The full InChI is InChI=1S/C24H18BrNO4/c1-28-21-9-7-17(8-10-21)19(15-26)12-16-6-11-22(23(13-16)29-2)30-24(27)18-4-3-5-20(25)14-18/h3-14H,1-2H3/b19-12-.
What are the key properties of [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate?
[4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate has a molecular weight of 464.32 g/mol, XLogP of 5.75, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-bromobenzoate is sourced from PubChem (CID 39114660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).