C19H15NO6 — CID 56777674
(Z)-2-cyano-3-[3-methoxy-4-(4-methoxybenzoyl)oxyphenyl]prop-2-enoic acid (PubChem CID 56777674) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-methoxy-4-(4-methoxybenzoyl)oxyphenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[3-methoxy-4-(4-methoxybenzoyl)oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 56777674 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (Z)-2-cyano-3-[3-methoxy-4-(4-methoxybenzoyl)oxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C(/C#N)C(=O)O)cc2OC)cc1 |
| InChI | InChI=1S/C19H15NO6/c1-24-15-6-4-13(5-7-15)19(23)26-16-8-3-12(10-17(16)25-2)9-14(11-20)18(21)22/h3-10H,1-2H3,(H,21,22)/b14-9- |
| InChIKey | RSNHDOZPAKTUOQ-ZROIWOOFSA-N |
| XLogP | 2.91 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|