C21H18FNO6 — CID 3271004
[4-[2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 3271004) has the molecular formula C21H18FNO6 and a molecular weight of 399.37 g/mol. Its IUPAC name is [4-[2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 3271004 |
| Molecular Formula | C21H18FNO6 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | [4-[2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COCCOC(=O)C(C#N)=Cc1ccc(OC(=O)c2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H18FNO6/c1-26-9-10-28-20(24)16(13-23)11-14-3-8-18(19(12-14)27-2)29-21(25)15-4-6-17(22)7-5-15/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | TYHWGRIVMARAIP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|