C25H20FNO5 — CID 39114487
[4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 39114487) has the molecular formula C25H20FNO5 and a molecular weight of 433.44 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 39114487 |
| Molecular Formula | C25H20FNO5 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)c3ccc(F)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H20FNO5/c1-29-21-11-7-18(14-24(21)31-3)19(15-27)12-16-4-10-22(23(13-16)30-2)32-25(28)17-5-8-20(26)9-6-17/h4-14H,1-3H3/b19-12- |
| InChIKey | XVAUCDRPMCEXSD-UNOMPAQXSA-N |
| XLogP | 5.13 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|