C26H22ClNO6 — CID 3334929
[4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 3334929) has the molecular formula C26H22ClNO6 and a molecular weight of 479.92 g/mol. Its IUPAC name is [4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3334929 |
| Molecular Formula | C26H22ClNO6 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | [4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C=C(C#N)c2ccc(Cl)cc2)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C26H22ClNO6/c1-30-22-12-16(11-19(15-28)17-6-8-20(27)9-7-17)5-10-21(22)34-26(29)18-13-23(31-2)25(33-4)24(14-18)32-3/h5-14H,1-4H3 |
| InChIKey | HRARMJLJTCWDBD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|