C26H22ClNO4 — CID 19170598
[4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 19170598) has the molecular formula C26H22ClNO4 and a molecular weight of 447.92 g/mol. Its IUPAC name is [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19170598 |
| Molecular Formula | C26H22ClNO4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | [4-[(Z)-2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | COc1cc(/C=C(\C#N)c2ccc(Cl)cc2)ccc1OC(=O)COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C26H22ClNO4/c1-17-4-10-23(12-18(17)2)31-16-26(29)32-24-11-5-19(14-25(24)30-3)13-21(15-28)20-6-8-22(27)9-7-20/h4-14H,16H2,1-3H3/b21-13+ |
| InChIKey | KZAVJADNWSZGQZ-FYJGNVAPSA-N |
| XLogP | 6.01 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|