C27H25NO7 — CID 39114524
[4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 2-(3-methoxyphenoxy)acetate (PubChem CID 39114524) has the molecular formula C27H25NO7 and a molecular weight of 475.50 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 2-(3-methoxyphenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 2-(3-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 39114524 |
| Molecular Formula | C27H25NO7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]-2-methoxyphenyl] 2-(3-methoxyphenoxy)acetate |
| SMILES | COc1cccc(OCC(=O)Oc2ccc(/C=C(/C#N)c3ccc(OC)c(OC)c3)cc2OC)c1 |
| InChI | InChI=1S/C27H25NO7/c1-30-21-6-5-7-22(15-21)34-17-27(29)35-24-10-8-18(13-25(24)32-3)12-20(16-28)19-9-11-23(31-2)26(14-19)33-4/h5-15H,17H2,1-4H3/b20-12- |
| InChIKey | WWRPABJSYVDGQY-NDENLUEZSA-N |
| XLogP | 4.77 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|