C25H20ClNO5 — CID 39115363
[3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(2-chlorophenoxy)acetate (PubChem CID 39115363) has the molecular formula C25H20ClNO5 and a molecular weight of 449.89 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(2-chlorophenoxy)acetate.
| Compound Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 39115363 |
| Molecular Formula | C25H20ClNO5 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(2-chlorophenoxy)acetate |
| SMILES | COc1ccc(/C(C#N)=C\c2cccc(OC(=O)COc3ccccc3Cl)c2)cc1OC |
| InChI | InChI=1S/C25H20ClNO5/c1-29-23-11-10-18(14-24(23)30-2)19(15-27)12-17-6-5-7-20(13-17)32-25(28)16-31-22-9-4-3-8-21(22)26/h3-14H,16H2,1-2H3/b19-12- |
| InChIKey | OQUFVBOMHQKXLY-UNOMPAQXSA-N |
| XLogP | 5.41 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|