C26H23NO4 — CID 39115578
[3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-(2,3-dimethylphenoxy)acetate (PubChem CID 39115578) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-(2,3-dimethylphenoxy)acetate.
| Compound Name | [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-(2,3-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 39115578 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [3-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]phenyl] 2-(2,3-dimethylphenoxy)acetate |
| SMILES | COc1ccc(/C(C#N)=C\c2cccc(OC(=O)COc3cccc(C)c3C)c2)cc1 |
| InChI | InChI=1S/C26H23NO4/c1-18-6-4-9-25(19(18)2)30-17-26(28)31-24-8-5-7-20(15-24)14-22(16-27)21-10-12-23(29-3)13-11-21/h4-15H,17H2,1-3H3/b22-14- |
| InChIKey | IDEIVWMCZJYZIY-HMAPJEAMSA-N |
| XLogP | 5.36 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|