C27H25NO6 — CID 39115398
[3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 39115398) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 39115398 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | [3-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2cccc(/C=C(/C#N)c3ccc(OC)c(OC)c3)c2)cc1OC |
| InChI | InChI=1S/C27H25NO6/c1-30-23-10-8-19(14-25(23)32-3)15-27(29)34-22-7-5-6-18(13-22)12-21(17-28)20-9-11-24(31-2)26(16-20)33-4/h5-14,16H,15H2,1-4H3/b21-12- |
| InChIKey | ALVYRCRKAZVXAL-MTJSOVHGSA-N |
| XLogP | 4.93 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|