C22H21NO6 — CID 69270180
4-O-[4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 1-O-methyl butanedioate (PubChem CID 69270180) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is 4-O-[4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 69270180 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-O-[4-[2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)Oc1ccc(C=C(C#N)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H21NO6/c1-26-19-9-6-16(13-20(19)27-2)17(14-23)12-15-4-7-18(8-5-15)29-22(25)11-10-21(24)28-3/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | BCLHLASDBIXCIV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|