C21H21NO5 — CID 69273149
2-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]butanoic acid (PubChem CID 69273149) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]butanoic acid.
| Compound Name | 2-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 69273149 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1ccc(/C=C(\C#N)c2ccc(OC)c(OC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C21H21NO5/c1-4-18(21(23)24)27-17-8-5-14(6-9-17)11-16(13-22)15-7-10-19(25-2)20(12-15)26-3/h5-12,18H,4H2,1-3H3,(H,23,24)/b16-11+ |
| InChIKey | RUMGXBXSINBRCD-LFIBNONCSA-N |
| XLogP | 4.01 |
| TPSA | 88.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|