C19H17NO4 — CID 10041861
[4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] acetate (PubChem CID 10041861) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] acetate.
| Compound Name | [4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 10041861 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] acetate |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(OC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C19H17NO4/c1-13(21)24-17-7-4-14(5-8-17)10-16(12-20)15-6-9-18(22-2)19(11-15)23-3/h4-11H,1-3H3/b16-10+ |
| InChIKey | VUHCYXIZYYPGRP-MHWRWJLKSA-N |
| XLogP | 3.69 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|