C24H19NO4 — CID 39112650
[4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 39112650) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 39112650 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=C(/C#N)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C24H19NO4/c1-27-22-13-10-19(15-23(22)28-2)24(26)29-21-11-8-17(9-12-21)14-20(16-25)18-6-4-3-5-7-18/h3-15H,1-2H3/b20-14- |
| InChIKey | ACOFEIGZMCMMDG-ZHZULCJRSA-N |
| XLogP | 4.99 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|