C25H23NO4 — CID 4296561
2-(3,4-dimethoxyphenyl)-3-[4-(2-phenoxyethoxy)phenyl]prop-2-enenitrile (PubChem CID 4296561) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-[4-(2-phenoxyethoxy)phenyl]prop-2-enenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-[4-(2-phenoxyethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4296561 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-[4-(2-phenoxyethoxy)phenyl]prop-2-enenitrile |
| SMILES | COc1ccc(C(C#N)=Cc2ccc(OCCOc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H23NO4/c1-27-24-13-10-20(17-25(24)28-2)21(18-26)16-19-8-11-23(12-9-19)30-15-14-29-22-6-4-3-5-7-22/h3-13,16-17H,14-15H2,1-2H3 |
| InChIKey | FTWUAPGNQXBFSU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|