C18H14N2O2 — CID 10401953
4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzonitrile (PubChem CID 10401953) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzonitrile.
| Compound Name | 4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 10401953 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]benzonitrile |
| SMILES | COc1ccc(/C(C#N)=C/c2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C18H14N2O2/c1-21-17-8-7-15(10-18(17)22-2)16(12-20)9-13-3-5-14(11-19)6-4-13/h3-10H,1-2H3/b16-9+ |
| InChIKey | GXJWKVOXYULKCL-CXUHLZMHSA-N |
| XLogP | 3.64 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|