C18H15NO3 — CID 7947742
4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzonitrile (PubChem CID 7947742) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 7947742 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzonitrile |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C18H15NO3/c1-21-17-10-8-15(11-18(17)22-2)16(20)9-7-13-3-5-14(12-19)6-4-13/h3-11H,1-2H3/b9-7+ |
| InChIKey | FXRZUYOVRPPVJO-VQHVLOKHSA-N |
| XLogP | 3.47 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|