C18H15NO — CID 4811071
4-[3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]benzonitrile (PubChem CID 4811071) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]benzonitrile.
| Compound Name | 4-[3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 4811071 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-[3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]benzonitrile |
| SMILES | Cc1ccc(C(=O)C=Cc2ccc(C#N)cc2)cc1C |
| InChI | InChI=1S/C18H15NO/c1-13-3-9-17(11-14(13)2)18(20)10-8-15-4-6-16(12-19)7-5-15/h3-11H,1-2H3 |
| InChIKey | IGDICNZGRMLTNC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|