C19H17O4- — CID 8858211
2-[4-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]acetate (PubChem CID 8858211) has the molecular formula C19H17O4- and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[4-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8858211 |
| Molecular Formula | C19H17O4- |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[4-[(E)-3-(3,4-dimethylphenyl)-3-oxoprop-1-enyl]phenoxy]acetate |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(OCC(=O)[O-])cc2)cc1C |
| InChI | InChI=1S/C19H18O4/c1-13-3-7-16(11-14(13)2)18(20)10-6-15-4-8-17(9-5-15)23-12-19(21)22/h3-11H,12H2,1-2H3,(H,21,22)/p-1/b10-6+ |
| InChIKey | USFDGVYVQHBYEC-UXBLZVDNSA-M |
| XLogP | 2.33 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|