C21H22NO4- — CID 8727469
2-[3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]acetate (PubChem CID 8727469) has the molecular formula C21H22NO4- and a molecular weight of 352.41 g/mol. Its IUPAC name is 2-[3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]acetate.
| Compound Name | 2-[3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 8727469 |
| Molecular Formula | C21H22NO4- |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[3-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]acetate |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)c2cccc(OCC(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-3-22(4-2)18-11-8-16(9-12-18)10-13-20(23)17-6-5-7-19(14-17)26-15-21(24)25/h5-14H,3-4,15H2,1-2H3,(H,24,25)/p-1/b13-10+ |
| InChIKey | WEXHKDZCCCTYLV-JLHYYAGUSA-M |
| XLogP | 2.56 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|