C23H28N2O3 — CID 8684788
2-[4-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 8684788) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[4-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 8684788 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[4-[(E)-3-[4-(diethylamino)phenyl]prop-2-enoyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CCN(CC)c1ccc(/C=C/C(=O)c2ccc(OCC(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-25(6-2)20-12-7-18(8-13-20)9-16-22(26)19-10-14-21(15-11-19)28-17-23(27)24(3)4/h7-16H,5-6,17H2,1-4H3/b16-9+ |
| InChIKey | HWIBSSSPKSIVKU-CXUHLZMHSA-N |
| XLogP | 3.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|