C19H16ClO6- — CID 9448861
2-[3-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]phenoxy]acetate (PubChem CID 9448861) has the molecular formula C19H16ClO6- and a molecular weight of 375.78 g/mol. Its IUPAC name is 2-[3-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]phenoxy]acetate.
| Compound Name | 2-[3-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9448861 |
| Molecular Formula | C19H16ClO6- |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-[3-[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]phenoxy]acetate |
| SMILES | COc1cc(/C=C/C(=O)c2cccc(OCC(=O)[O-])c2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H17ClO6/c1-24-17-9-12(8-15(20)19(17)25-2)6-7-16(21)13-4-3-5-14(10-13)26-11-18(22)23/h3-10H,11H2,1-2H3,(H,22,23)/p-1/b7-6+ |
| InChIKey | LUNSPPSDRMNAQE-VOTSOKGWSA-M |
| XLogP | 2.38 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|