C26H24Cl2O6 — CID 155779696
3-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 155779696) has the molecular formula C26H24Cl2O6 and a molecular weight of 503.38 g/mol. Its IUPAC name is 3-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155779696 |
| Molecular Formula | C26H24Cl2O6 |
| Molecular Weight | 503.38 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 3-[3-chloro-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc(Cl)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H24Cl2O6/c1-30-22-12-16(11-20(28)25(22)34-15-17-6-5-7-19(27)10-17)8-9-21(29)18-13-23(31-2)26(33-4)24(14-18)32-3/h5-14H,15H2,1-4H3 |
| InChIKey | QZMBRKIBRGMKRC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.38 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|