C24H19BrClNO4 — CID 155779685
3-[3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoyl]benzamide (PubChem CID 155779685) has the molecular formula C24H19BrClNO4 and a molecular weight of 500.78 g/mol. Its IUPAC name is 3-[3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoyl]benzamide.
| Compound Name | 3-[3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoyl]benzamide |
|---|---|
| PubChem CID | 155779685 |
| Molecular Formula | C24H19BrClNO4 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 3-[3-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enoyl]benzamide |
| SMILES | COc1cc(C=CC(=O)c2cccc(C(N)=O)c2)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H19BrClNO4/c1-30-22-12-15(8-9-21(28)17-5-3-6-18(13-17)24(27)29)11-20(25)23(22)31-14-16-4-2-7-19(26)10-16/h2-13H,14H2,1H3,(H2,27,29) |
| InChIKey | GIZNIPNPEQNQHC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|