C25H24BrClN2O5 — CID 126315876
N-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126315876) has the molecular formula C25H24BrClN2O5 and a molecular weight of 547.83 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126315876 |
| Molecular Formula | C25H24BrClN2O5 |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(3-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc(OC)c(OC)c2)cc(Br)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H24BrClN2O5/c1-4-33-23-12-17(11-20(26)24(23)34-15-16-6-5-7-19(27)10-16)14-28-29-25(30)18-8-9-21(31-2)22(13-18)32-3/h5-14H,4,15H2,1-3H3,(H,29,30)/b28-14+ |
| InChIKey | LPXBFHPHWMQGNR-CCVNUDIWSA-N |
| XLogP | 5.86 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|