C27H26ClNO7 — CID 155779691
3-[[2-chloro-6-methoxy-4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]methyl]benzamide (PubChem CID 155779691) has the molecular formula C27H26ClNO7 and a molecular weight of 511.96 g/mol. Its IUPAC name is 3-[[2-chloro-6-methoxy-4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]methyl]benzamide.
| Compound Name | 3-[[2-chloro-6-methoxy-4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]methyl]benzamide |
|---|---|
| PubChem CID | 155779691 |
| Molecular Formula | C27H26ClNO7 |
| Molecular Weight | 511.96 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 3-[[2-chloro-6-methoxy-4-[3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenoxy]methyl]benzamide |
| SMILES | COc1cc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc(Cl)c1OCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C27H26ClNO7/c1-32-22-12-16(8-9-21(30)19-13-23(33-2)26(35-4)24(14-19)34-3)11-20(28)25(22)36-15-17-6-5-7-18(10-17)27(29)31/h5-14H,15H2,1-4H3,(H2,29,31) |
| InChIKey | VQOUBYHCXWYGQS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|