C20H21ClO6 — CID 3980689
3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 3980689) has the molecular formula C20H21ClO6 and a molecular weight of 392.84 g/mol. Its IUPAC name is 3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3980689 |
| Molecular Formula | C20H21ClO6 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 3-(3-chloro-4,5-dimethoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C20H21ClO6/c1-23-16-9-12(8-14(21)19(16)26-4)6-7-15(22)13-10-17(24-2)20(27-5)18(11-13)25-3/h6-11H,1-5H3 |
| InChIKey | SKAOXACCZOQGQL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|