C21H17ClO3 — CID 5042284
3-(3-chloro-4,5-dimethoxyphenyl)-1-naphthalen-2-ylprop-2-en-1-one (PubChem CID 5042284) has the molecular formula C21H17ClO3 and a molecular weight of 352.82 g/mol. Its IUPAC name is 3-(3-chloro-4,5-dimethoxyphenyl)-1-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | 3-(3-chloro-4,5-dimethoxyphenyl)-1-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 5042284 |
| Molecular Formula | C21H17ClO3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-(3-chloro-4,5-dimethoxyphenyl)-1-naphthalen-2-ylprop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc3ccccc3c2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H17ClO3/c1-24-20-12-14(11-18(22)21(20)25-2)7-10-19(23)17-9-8-15-5-3-4-6-16(15)13-17/h3-13H,1-2H3 |
| InChIKey | FENLVBNHYJPVDC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|