C11H10ClO4- — CID 2414116
(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2414116) has the molecular formula C11H10ClO4- and a molecular weight of 241.65 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2414116 |
| Molecular Formula | C11H10ClO4- |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)[O-])cc(Cl)c1OC |
| InChI | InChI=1S/C11H11ClO4/c1-15-9-6-7(3-4-10(13)14)5-8(12)11(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
| InChIKey | FZFFFBWBOZMKEP-ONEGZZNKSA-M |
| XLogP | 1.12 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|