C11H11NaO5 — CID 139662068
sodium (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 139662068) has the molecular formula C11H11NaO5 and a molecular weight of 246.19 g/mol. Its IUPAC name is sodium (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | sodium (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 139662068 |
| Molecular Formula | C11H11NaO5 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | sodium (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)[O-])cc(OC)c1O.[Na+] |
| InChI | InChI=1S/C11H12O5.Na/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14;/h3-6,14H,1-2H3,(H,12,13);/q;+1/p-1/b4-3+; |
| InChIKey | FDFSSDOKMNMBEB-BJILWQEISA-M |
| XLogP | -2.82 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|