C24H26O8 — CID 73438577
(1E,6E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 73438577) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is (1E,6E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 73438577 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (1E,6E)-1-(4-hydroxy-3,5-dimethoxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc(OC)c1O |
| InChI | InChI=1S/C24H26O8/c1-28-19-10-15(11-20(29-2)23(19)27)6-8-17(25)14-18(26)9-7-16-12-21(30-3)24(32-5)22(13-16)31-4/h6-13,27H,14H2,1-5H3/b8-6+,9-7+ |
| InChIKey | CEAQWKGOLKYGBS-CDJQDVQCSA-N |
| XLogP | 3.69 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|