C16H18O6 — CID 134156123
[4-[(E)-3,5-dioxohex-1-enyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 134156123) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is [4-[(E)-3,5-dioxohex-1-enyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(E)-3,5-dioxohex-1-enyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 134156123 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [4-[(E)-3,5-dioxohex-1-enyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)CC(C)=O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C16H18O6/c1-10(17)7-13(19)6-5-12-8-14(20-3)16(22-11(2)18)15(9-12)21-4/h5-6,8-9H,7H2,1-4H3/b6-5+ |
| InChIKey | FPSPUSNXFDCBCH-AATRIKPKSA-N |
| XLogP | 2.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|