C22H22O7 — CID 118722821
(1E,6E)-1-(3,4-dihydroxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 118722821) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is (1E,6E)-1-(3,4-dihydroxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(3,4-dihydroxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 118722821 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (1E,6E)-1-(3,4-dihydroxyphenyl)-7-(3,4,5-trimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22O7/c1-27-20-11-15(12-21(28-2)22(20)29-3)5-8-17(24)13-16(23)7-4-14-6-9-18(25)19(26)10-14/h4-12,25-26H,13H2,1-3H3/b7-4+,8-5+ |
| InChIKey | LFRPIEBOCOLPAZ-NSLJXJERSA-N |
| XLogP | 3.38 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|