C27H27NO8 — CID 135359873
(E)-3-(3,4-dihydroxyphenyl)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359873) has the molecular formula C27H27NO8 and a molecular weight of 493.51 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359873 |
| Molecular Formula | C27H27NO8 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(C=Cc2ccc(O)c(OC)c2NC(=O)/C=C/c2ccc(O)c(O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H27NO8/c1-33-22-14-17(15-23(34-2)27(22)36-4)5-8-18-9-11-20(30)26(35-3)25(18)28-24(32)12-7-16-6-10-19(29)21(31)13-16/h5-15,29-31H,1-4H3,(H,28,32)/b8-5?,12-7+ |
| InChIKey | GIIRRLZITTYFKG-RZOVKRSGSA-N |
| XLogP | 4.66 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|