C27H26N2O8 — CID 135359987
(E)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 135359987) has the molecular formula C27H26N2O8 and a molecular weight of 506.51 g/mol. Its IUPAC name is (E)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 135359987 |
| Molecular Formula | C27H26N2O8 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | (E)-N-[3-hydroxy-2-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc(C=Cc2ccc(O)c(OC)c2NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26N2O8/c1-34-22-15-18(16-23(35-2)27(22)37-4)8-10-19-11-12-21(30)26(36-3)25(19)28-24(31)13-9-17-6-5-7-20(14-17)29(32)33/h5-16,30H,1-4H3,(H,28,31)/b10-8?,13-9+ |
| InChIKey | XVUCMPUUWSGEGD-CRMCATFDSA-N |
| XLogP | 5.16 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|