C15H20O4 — CID 14723786
(E)-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one (PubChem CID 14723786) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one.
| Compound Name | (E)-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one |
|---|---|
| PubChem CID | 14723786 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (E)-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one |
| SMILES | CCCC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20O4/c1-5-6-12(16)8-7-11-9-13(17-2)15(19-4)14(10-11)18-3/h7-10H,5-6H2,1-4H3/b8-7+ |
| InChIKey | GDHPMPRYJVAESO-BQYQJAHWSA-N |
| XLogP | 3.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|