C21H25ClN2O6 — CID 175256072
ethyl 3-[3-oxo-5-(3,4,5-trimethoxyphenyl)pent-4-enyl]pyrazine-2-carboxylate;hydrochloride (PubChem CID 175256072) has the molecular formula C21H25ClN2O6 and a molecular weight of 436.89 g/mol. Its IUPAC name is ethyl 3-[3-oxo-5-(3,4,5-trimethoxyphenyl)pent-4-enyl]pyrazine-2-carboxylate;hydrochloride.
| Compound Name | ethyl 3-[3-oxo-5-(3,4,5-trimethoxyphenyl)pent-4-enyl]pyrazine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 175256072 |
| Molecular Formula | C21H25ClN2O6 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | ethyl 3-[3-oxo-5-(3,4,5-trimethoxyphenyl)pent-4-enyl]pyrazine-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1nccnc1CCC(=O)C=Cc1cc(OC)c(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C21H24N2O6.ClH/c1-5-29-21(25)19-16(22-10-11-23-19)9-8-15(24)7-6-14-12-17(26-2)20(28-4)18(13-14)27-3;/h6-7,10-13H,5,8-9H2,1-4H3;1H |
| InChIKey | KUMHJSXOHYIRKL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|