C21H23BrO6 — CID 4812882
3-(3-bromo-4-ethoxy-5-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 4812882) has the molecular formula C21H23BrO6 and a molecular weight of 451.31 g/mol. Its IUPAC name is 3-(3-bromo-4-ethoxy-5-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-bromo-4-ethoxy-5-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4812882 |
| Molecular Formula | C21H23BrO6 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3-(3-bromo-4-ethoxy-5-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1c(Br)cc(C=CC(=O)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H23BrO6/c1-6-28-20-15(22)9-13(10-17(20)24-2)7-8-16(23)14-11-18(25-3)21(27-5)19(12-14)26-4/h7-12H,6H2,1-5H3 |
| InChIKey | BROLDYBDDIYHTQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|